SUNBRIGHT FM-020HC is a heterobifunctional PEG derivative with a 2,000 Da PEG chain, featuring a 9-Fluorenylmethyloxycarbonyl(FMOC)-protected amine group at one end and a carboxylic acid group at the other. FM-020HC is particularly useful for creating precise and controlled heteroconjugates, crosslinking biomolecules, and functionalizing surfaces.
Fmoc-PEG-C5-Carboxic Acid
Fmoc-NH-(CH2)3O-(CH2CH2O)n-(CH2)5-COOH MW 2,000
Package size: 1g amber glass bottle
*Make to order
